C21H23N5O6 — CID 166426937
4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-5-carbonyl]-N,N-dimethylpiperazine-1-carboxamide (PubChem CID 166426937) has the molecular formula C21H23N5O6 and a molecular weight of 441.44 g/mol. Its IUPAC name is 4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-5-carbonyl]-N,N-dimethylpiperazine-1-carboxamide.
| Compound Name | 4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-5-carbonyl]-N,N-dimethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 166426937 |
| Molecular Formula | C21H23N5O6 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-5-carbonyl]-N,N-dimethylpiperazine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCN(C(=O)c2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C21H23N5O6/c1-23(2)21(32)25-9-7-24(8-10-25)18(29)12-3-4-13-14(11-12)20(31)26(19(13)30)15-5-6-16(27)22-17(15)28/h3-4,11,15H,5-10H2,1-2H3,(H,22,27,28) |
| InChIKey | MNDGJZGICOUDBZ-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|