C23H22N6O7 — CID 168882586
5-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazine-1-carbonyl]-1-methylpyrazole-3-carboxylic acid (PubChem CID 168882586) has the molecular formula C23H22N6O7 and a molecular weight of 494.46 g/mol. Its IUPAC name is 5-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazine-1-carbonyl]-1-methylpyrazole-3-carboxylic acid.
| Compound Name | 5-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazine-1-carbonyl]-1-methylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 168882586 |
| Molecular Formula | C23H22N6O7 |
| Molecular Weight | 494.46 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 5-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazine-1-carbonyl]-1-methylpyrazole-3-carboxylic acid |
| SMILES | Cn1nc(C(=O)O)cc1C(=O)N1CCN(c2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C23H22N6O7/c1-26-17(11-15(25-26)23(35)36)22(34)28-8-6-27(7-9-28)12-2-3-13-14(10-12)21(33)29(20(13)32)16-4-5-18(30)24-19(16)31/h2-3,10-11,16H,4-9H2,1H3,(H,35,36)(H,24,30,31) |
| InChIKey | RZCGOEJUEVPRFG-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 162.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.46 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|