C20H26N4O4 — CID 108568252
N,N-dimethyl-4-[2-(2-methylpropyl)-1,3-dioxoisoindole-5-carbonyl]piperazine-1-carboxamide (PubChem CID 108568252) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-(2-methylpropyl)-1,3-dioxoisoindole-5-carbonyl]piperazine-1-carboxamide.
| Compound Name | N,N-dimethyl-4-[2-(2-methylpropyl)-1,3-dioxoisoindole-5-carbonyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 108568252 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | N,N-dimethyl-4-[2-(2-methylpropyl)-1,3-dioxoisoindole-5-carbonyl]piperazine-1-carboxamide |
| SMILES | CC(C)CN1C(=O)c2ccc(C(=O)N3CCN(C(=O)N(C)C)CC3)cc2C1=O |
| InChI | InChI=1S/C20H26N4O4/c1-13(2)12-24-18(26)15-6-5-14(11-16(15)19(24)27)17(25)22-7-9-23(10-8-22)20(28)21(3)4/h5-6,11,13H,7-10,12H2,1-4H3 |
| InChIKey | YWICEMFHPGCTFG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|