C22H29N3O5 — CID 108568251
butyl 4-[2-(2-methylpropyl)-1,3-dioxoisoindole-5-carbonyl]piperazine-1-carboxylate (PubChem CID 108568251) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is butyl 4-[2-(2-methylpropyl)-1,3-dioxoisoindole-5-carbonyl]piperazine-1-carboxylate.
| Compound Name | butyl 4-[2-(2-methylpropyl)-1,3-dioxoisoindole-5-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108568251 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | butyl 4-[2-(2-methylpropyl)-1,3-dioxoisoindole-5-carbonyl]piperazine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCN(C(=O)c2ccc3c(c2)C(=O)N(CC(C)C)C3=O)CC1 |
| InChI | InChI=1S/C22H29N3O5/c1-4-5-12-30-22(29)24-10-8-23(9-11-24)19(26)16-6-7-17-18(13-16)21(28)25(20(17)27)14-15(2)3/h6-7,13,15H,4-5,8-12,14H2,1-3H3 |
| InChIKey | WINNVORDFAOCIC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|