C23H25N3O5 — CID 108544705
5-[4-(furan-2-carbonyl)-1,4-diazepane-1-carbonyl]-2-(2-methylpropyl)isoindole-1,3-dione (PubChem CID 108544705) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is 5-[4-(furan-2-carbonyl)-1,4-diazepane-1-carbonyl]-2-(2-methylpropyl)isoindole-1,3-dione.
| Compound Name | 5-[4-(furan-2-carbonyl)-1,4-diazepane-1-carbonyl]-2-(2-methylpropyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 108544705 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 5-[4-(furan-2-carbonyl)-1,4-diazepane-1-carbonyl]-2-(2-methylpropyl)isoindole-1,3-dione |
| SMILES | CC(C)CN1C(=O)c2ccc(C(=O)N3CCCN(C(=O)c4ccco4)CC3)cc2C1=O |
| InChI | InChI=1S/C23H25N3O5/c1-15(2)14-26-21(28)17-7-6-16(13-18(17)22(26)29)20(27)24-8-4-9-25(11-10-24)23(30)19-5-3-12-31-19/h3,5-7,12-13,15H,4,8-11,14H2,1-2H3 |
| InChIKey | UUIGXJARSPKEOF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|