C23H31N3O4 — CID 108568248
5-[4-(3,3-dimethylbutanoyl)piperazine-1-carbonyl]-2-(2-methylpropyl)isoindole-1,3-dione (PubChem CID 108568248) has the molecular formula C23H31N3O4 and a molecular weight of 413.52 g/mol. Its IUPAC name is 5-[4-(3,3-dimethylbutanoyl)piperazine-1-carbonyl]-2-(2-methylpropyl)isoindole-1,3-dione.
| Compound Name | 5-[4-(3,3-dimethylbutanoyl)piperazine-1-carbonyl]-2-(2-methylpropyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 108568248 |
| Molecular Formula | C23H31N3O4 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | 5-[4-(3,3-dimethylbutanoyl)piperazine-1-carbonyl]-2-(2-methylpropyl)isoindole-1,3-dione |
| SMILES | CC(C)CN1C(=O)c2ccc(C(=O)N3CCN(C(=O)CC(C)(C)C)CC3)cc2C1=O |
| InChI | InChI=1S/C23H31N3O4/c1-15(2)14-26-21(29)17-7-6-16(12-18(17)22(26)30)20(28)25-10-8-24(9-11-25)19(27)13-23(3,4)5/h6-7,12,15H,8-11,13-14H2,1-5H3 |
| InChIKey | OIUUOPZOZBPJHU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|