C23H25N3O6 — CID 108544708
5-[4-(furan-2-carbonyl)-1,4-diazepane-1-carbonyl]-2-(3-methoxypropyl)isoindole-1,3-dione (PubChem CID 108544708) has the molecular formula C23H25N3O6 and a molecular weight of 439.47 g/mol. Its IUPAC name is 5-[4-(furan-2-carbonyl)-1,4-diazepane-1-carbonyl]-2-(3-methoxypropyl)isoindole-1,3-dione.
| Compound Name | 5-[4-(furan-2-carbonyl)-1,4-diazepane-1-carbonyl]-2-(3-methoxypropyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 108544708 |
| Molecular Formula | C23H25N3O6 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 5-[4-(furan-2-carbonyl)-1,4-diazepane-1-carbonyl]-2-(3-methoxypropyl)isoindole-1,3-dione |
| SMILES | COCCCN1C(=O)c2ccc(C(=O)N3CCCN(C(=O)c4ccco4)CC3)cc2C1=O |
| InChI | InChI=1S/C23H25N3O6/c1-31-13-4-10-26-21(28)17-7-6-16(15-18(17)22(26)29)20(27)24-8-3-9-25(12-11-24)23(30)19-5-2-14-32-19/h2,5-7,14-15H,3-4,8-13H2,1H3 |
| InChIKey | SMQDRDCOQLXONL-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 100.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|