C21H26ClN3O5 — CID 108564596
2-chloro-N-[1-[2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carbonyl]piperidin-4-yl]propanamide (PubChem CID 108564596) has the molecular formula C21H26ClN3O5 and a molecular weight of 435.91 g/mol. Its IUPAC name is 2-chloro-N-[1-[2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carbonyl]piperidin-4-yl]propanamide.
| Compound Name | 2-chloro-N-[1-[2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carbonyl]piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 108564596 |
| Molecular Formula | C21H26ClN3O5 |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 2-chloro-N-[1-[2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carbonyl]piperidin-4-yl]propanamide |
| SMILES | COCCCN1C(=O)c2ccc(C(=O)N3CCC(NC(=O)C(C)Cl)CC3)cc2C1=O |
| InChI | InChI=1S/C21H26ClN3O5/c1-13(22)18(26)23-15-6-9-24(10-7-15)19(27)14-4-5-16-17(12-14)21(29)25(20(16)28)8-3-11-30-2/h4-5,12-13,15H,3,6-11H2,1-2H3,(H,23,26) |
| InChIKey | CSNRNLJHCNJTQS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|