C21H29N3O6S — CID 55674176
N-[1-[2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carbonyl]piperidin-4-yl]propane-1-sulfonamide (PubChem CID 55674176) has the molecular formula C21H29N3O6S and a molecular weight of 451.55 g/mol. Its IUPAC name is N-[1-[2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carbonyl]piperidin-4-yl]propane-1-sulfonamide.
| Compound Name | N-[1-[2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carbonyl]piperidin-4-yl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 55674176 |
| Molecular Formula | C21H29N3O6S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | N-[1-[2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carbonyl]piperidin-4-yl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NC1CCN(C(=O)c2ccc3c(c2)C(=O)N(CCCOC)C3=O)CC1 |
| InChI | InChI=1S/C21H29N3O6S/c1-3-13-31(28,29)22-16-7-10-23(11-8-16)19(25)15-5-6-17-18(14-15)21(27)24(20(17)26)9-4-12-30-2/h5-6,14,16,22H,3-4,7-13H2,1-2H3 |
| InChIKey | FUQQSWNCSQUPDY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|