C21H27N3O5 — CID 108568215
2-methylpropyl 4-(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)piperazine-1-carboxylate (PubChem CID 108568215) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is 2-methylpropyl 4-(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)piperazine-1-carboxylate.
| Compound Name | 2-methylpropyl 4-(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108568215 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 2-methylpropyl 4-(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)piperazine-1-carboxylate |
| SMILES | CC(C)COC(=O)N1CCN(C(=O)c2ccc3c(c2)C(=O)N(C(C)C)C3=O)CC1 |
| InChI | InChI=1S/C21H27N3O5/c1-13(2)12-29-21(28)23-9-7-22(8-10-23)18(25)15-5-6-16-17(11-15)20(27)24(14(3)4)19(16)26/h5-6,11,13-14H,7-10,12H2,1-4H3 |
| InChIKey | DBNFDCBLRPJQAR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|