C22H27N3O5 — CID 108564492
prop-2-enyl N-[1-[2-(2-methylpropyl)-1,3-dioxoisoindole-5-carbonyl]piperidin-4-yl]carbamate (PubChem CID 108564492) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is prop-2-enyl N-[1-[2-(2-methylpropyl)-1,3-dioxoisoindole-5-carbonyl]piperidin-4-yl]carbamate.
| Compound Name | prop-2-enyl N-[1-[2-(2-methylpropyl)-1,3-dioxoisoindole-5-carbonyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 108564492 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | prop-2-enyl N-[1-[2-(2-methylpropyl)-1,3-dioxoisoindole-5-carbonyl]piperidin-4-yl]carbamate |
| SMILES | C=CCOC(=O)NC1CCN(C(=O)c2ccc3c(c2)C(=O)N(CC(C)C)C3=O)CC1 |
| InChI | InChI=1S/C22H27N3O5/c1-4-11-30-22(29)23-16-7-9-24(10-8-16)19(26)15-5-6-17-18(12-15)21(28)25(20(17)27)13-14(2)3/h4-6,12,14,16H,1,7-11,13H2,2-3H3,(H,23,29) |
| InChIKey | MHFZYASUOMHMFP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|