C22H27N3O5 — CID 108564579
prop-2-enyl N-[1-(2-tert-butyl-1,3-dioxoisoindole-5-carbonyl)piperidin-4-yl]carbamate (PubChem CID 108564579) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is prop-2-enyl N-[1-(2-tert-butyl-1,3-dioxoisoindole-5-carbonyl)piperidin-4-yl]carbamate.
| Compound Name | prop-2-enyl N-[1-(2-tert-butyl-1,3-dioxoisoindole-5-carbonyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 108564579 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | prop-2-enyl N-[1-(2-tert-butyl-1,3-dioxoisoindole-5-carbonyl)piperidin-4-yl]carbamate |
| SMILES | C=CCOC(=O)NC1CCN(C(=O)c2ccc3c(c2)C(=O)N(C(C)(C)C)C3=O)CC1 |
| InChI | InChI=1S/C22H27N3O5/c1-5-12-30-21(29)23-15-8-10-24(11-9-15)18(26)14-6-7-16-17(13-14)20(28)25(19(16)27)22(2,3)4/h5-7,13,15H,1,8-12H2,2-4H3,(H,23,29) |
| InChIKey | DPJYMTLCPXMVDR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|