C24H26N4O4 — CID 108551795
2-tert-butyl-1,3-dioxo-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]isoindole-5-carboxamide (PubChem CID 108551795) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is 2-tert-butyl-1,3-dioxo-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]isoindole-5-carboxamide.
| Compound Name | 2-tert-butyl-1,3-dioxo-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 108551795 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 2-tert-butyl-1,3-dioxo-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]isoindole-5-carboxamide |
| SMILES | CC(C)(C)N1C(=O)c2ccc(C(=O)NC3CCN(C(=O)c4ccncc4)CC3)cc2C1=O |
| InChI | InChI=1S/C24H26N4O4/c1-24(2,3)28-22(31)18-5-4-16(14-19(18)23(28)32)20(29)26-17-8-12-27(13-9-17)21(30)15-6-10-25-11-7-15/h4-7,10-11,14,17H,8-9,12-13H2,1-3H3,(H,26,29) |
| InChIKey | QWWZETPWRCPCHN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|