C24H33N3O4 — CID 108551790
2-tert-butyl-N-[1-(2-ethylbutanoyl)piperidin-4-yl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 108551790) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is 2-tert-butyl-N-[1-(2-ethylbutanoyl)piperidin-4-yl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-tert-butyl-N-[1-(2-ethylbutanoyl)piperidin-4-yl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 108551790 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 2-tert-butyl-N-[1-(2-ethylbutanoyl)piperidin-4-yl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CCC(CC)C(=O)N1CCC(NC(=O)c2ccc3c(c2)C(=O)N(C(C)(C)C)C3=O)CC1 |
| InChI | InChI=1S/C24H33N3O4/c1-6-15(7-2)21(29)26-12-10-17(11-13-26)25-20(28)16-8-9-18-19(14-16)23(31)27(22(18)30)24(3,4)5/h8-9,14-15,17H,6-7,10-13H2,1-5H3,(H,25,28) |
| InChIKey | QLIXQGXQFOVUTP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|