C18H23N3O4 — CID 108540454
2-tert-butyl-1,3-dioxo-N-[2-(propanoylamino)ethyl]isoindole-5-carboxamide (PubChem CID 108540454) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-tert-butyl-1,3-dioxo-N-[2-(propanoylamino)ethyl]isoindole-5-carboxamide.
| Compound Name | 2-tert-butyl-1,3-dioxo-N-[2-(propanoylamino)ethyl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 108540454 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 2-tert-butyl-1,3-dioxo-N-[2-(propanoylamino)ethyl]isoindole-5-carboxamide |
| SMILES | CCC(=O)NCCNC(=O)c1ccc2c(c1)C(=O)N(C(C)(C)C)C2=O |
| InChI | InChI=1S/C18H23N3O4/c1-5-14(22)19-8-9-20-15(23)11-6-7-12-13(10-11)17(25)21(16(12)24)18(2,3)4/h6-7,10H,5,8-9H2,1-4H3,(H,19,22)(H,20,23) |
| InChIKey | ZMPGXZRWHKEGKJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|