C24H27N3O4 — CID 108540464
2-tert-butyl-N-[2-[(3,4-dimethylbenzoyl)amino]ethyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 108540464) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is 2-tert-butyl-N-[2-[(3,4-dimethylbenzoyl)amino]ethyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-tert-butyl-N-[2-[(3,4-dimethylbenzoyl)amino]ethyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 108540464 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 2-tert-butyl-N-[2-[(3,4-dimethylbenzoyl)amino]ethyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | Cc1ccc(C(=O)NCCNC(=O)c2ccc3c(c2)C(=O)N(C(C)(C)C)C3=O)cc1C |
| InChI | InChI=1S/C24H27N3O4/c1-14-6-7-16(12-15(14)2)20(28)25-10-11-26-21(29)17-8-9-18-19(13-17)23(31)27(22(18)30)24(3,4)5/h6-9,12-13H,10-11H2,1-5H3,(H,25,28)(H,26,29) |
| InChIKey | RRNSIZQOBUSEDA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|