C24H26N4O5 — CID 108540436
N-[2-[(3-acetamidobenzoyl)amino]ethyl]-2-tert-butyl-1,3-dioxoisoindole-5-carboxamide (PubChem CID 108540436) has the molecular formula C24H26N4O5 and a molecular weight of 450.50 g/mol. Its IUPAC name is N-[2-[(3-acetamidobenzoyl)amino]ethyl]-2-tert-butyl-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[2-[(3-acetamidobenzoyl)amino]ethyl]-2-tert-butyl-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 108540436 |
| Molecular Formula | C24H26N4O5 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | N-[2-[(3-acetamidobenzoyl)amino]ethyl]-2-tert-butyl-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CC(=O)Nc1cccc(C(=O)NCCNC(=O)c2ccc3c(c2)C(=O)N(C(C)(C)C)C3=O)c1 |
| InChI | InChI=1S/C24H26N4O5/c1-14(29)27-17-7-5-6-15(12-17)20(30)25-10-11-26-21(31)16-8-9-18-19(13-16)23(33)28(22(18)32)24(2,3)4/h5-9,12-13H,10-11H2,1-4H3,(H,25,30)(H,26,31)(H,27,29) |
| InChIKey | MJRPINPVHZXROP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|