C20H25N3O5 — CID 108540445
2-tert-butyl-1,3-dioxo-N-[2-(oxolane-2-carbonylamino)ethyl]isoindole-5-carboxamide (PubChem CID 108540445) has the molecular formula C20H25N3O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is 2-tert-butyl-1,3-dioxo-N-[2-(oxolane-2-carbonylamino)ethyl]isoindole-5-carboxamide.
| Compound Name | 2-tert-butyl-1,3-dioxo-N-[2-(oxolane-2-carbonylamino)ethyl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 108540445 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 2-tert-butyl-1,3-dioxo-N-[2-(oxolane-2-carbonylamino)ethyl]isoindole-5-carboxamide |
| SMILES | CC(C)(C)N1C(=O)c2ccc(C(=O)NCCNC(=O)C3CCCO3)cc2C1=O |
| InChI | InChI=1S/C20H25N3O5/c1-20(2,3)23-18(26)13-7-6-12(11-14(13)19(23)27)16(24)21-8-9-22-17(25)15-5-4-10-28-15/h6-7,11,15H,4-5,8-10H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | IAQHUTVQHFVKJW-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|