C29H27N3O6 — CID 108929018
[3-[[3-[(2-tert-butyl-1,3-dioxoisoindole-5-carbonyl)amino]phenyl]methylcarbamoyl]phenyl] acetate (PubChem CID 108929018) has the molecular formula C29H27N3O6 and a molecular weight of 513.55 g/mol. Its IUPAC name is [3-[[3-[(2-tert-butyl-1,3-dioxoisoindole-5-carbonyl)amino]phenyl]methylcarbamoyl]phenyl] acetate.
| Compound Name | [3-[[3-[(2-tert-butyl-1,3-dioxoisoindole-5-carbonyl)amino]phenyl]methylcarbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108929018 |
| Molecular Formula | C29H27N3O6 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | [3-[[3-[(2-tert-butyl-1,3-dioxoisoindole-5-carbonyl)amino]phenyl]methylcarbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)NCc2cccc(NC(=O)c3ccc4c(c3)C(=O)N(C(C)(C)C)C4=O)c2)c1 |
| InChI | InChI=1S/C29H27N3O6/c1-17(33)38-22-10-6-8-19(14-22)25(34)30-16-18-7-5-9-21(13-18)31-26(35)20-11-12-23-24(15-20)28(37)32(27(23)36)29(2,3)4/h5-15H,16H2,1-4H3,(H,30,34)(H,31,35) |
| InChIKey | XFAHELVARVQIDC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|