C13H12NO4- — CID 7013506
2-tert-butyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 7013506) has the molecular formula C13H12NO4- and a molecular weight of 246.24 g/mol. Its IUPAC name is 2-tert-butyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | 2-tert-butyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 7013506 |
| Molecular Formula | C13H12NO4- |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 2-tert-butyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CC(C)(C)N1C(=O)c2ccc(C(=O)[O-])cc2C1=O |
| InChI | InChI=1S/C13H13NO4/c1-13(2,3)14-10(15)8-5-4-7(12(17)18)6-9(8)11(14)16/h4-6H,1-3H3,(H,17,18)/p-1 |
| InChIKey | XBMWXWYNYYVTMK-UHFFFAOYSA-M |
| XLogP | 0.44 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|