C20H20N4O4 — CID 108873391
4-[(2-tert-butyl-1,3-dioxoisoindol-5-yl)carbamoylamino]benzamide (PubChem CID 108873391) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is 4-[(2-tert-butyl-1,3-dioxoisoindol-5-yl)carbamoylamino]benzamide.
| Compound Name | 4-[(2-tert-butyl-1,3-dioxoisoindol-5-yl)carbamoylamino]benzamide |
|---|---|
| PubChem CID | 108873391 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 4-[(2-tert-butyl-1,3-dioxoisoindol-5-yl)carbamoylamino]benzamide |
| SMILES | CC(C)(C)N1C(=O)c2ccc(NC(=O)Nc3ccc(C(N)=O)cc3)cc2C1=O |
| InChI | InChI=1S/C20H20N4O4/c1-20(2,3)24-17(26)14-9-8-13(10-15(14)18(24)27)23-19(28)22-12-6-4-11(5-7-12)16(21)25/h4-10H,1-3H3,(H2,21,25)(H2,22,23,28) |
| InChIKey | ULOFNBWDBFDNPO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|