C20H21N3O4 — CID 108873285
1-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-3-(3-methoxyphenyl)urea (PubChem CID 108873285) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is 1-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-3-(3-methoxyphenyl)urea.
| Compound Name | 1-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 108873285 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 1-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)Nc2ccc3c(c2)C(=O)N(C(C)(C)C)C3=O)c1 |
| InChI | InChI=1S/C20H21N3O4/c1-20(2,3)23-17(24)15-9-8-13(11-16(15)18(23)25)22-19(26)21-12-6-5-7-14(10-12)27-4/h5-11H,1-4H3,(H2,21,22,26) |
| InChIKey | XRNNUOVSPMFGAM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|