C20H19N5O3 — CID 108873385
1-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-3-(1H-indazol-6-yl)urea (PubChem CID 108873385) has the molecular formula C20H19N5O3 and a molecular weight of 377.40 g/mol. Its IUPAC name is 1-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-3-(1H-indazol-6-yl)urea.
| Compound Name | 1-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-3-(1H-indazol-6-yl)urea |
|---|---|
| PubChem CID | 108873385 |
| Molecular Formula | C20H19N5O3 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 1-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-3-(1H-indazol-6-yl)urea |
| SMILES | CC(C)(C)N1C(=O)c2ccc(NC(=O)Nc3ccc4cn[nH]c4c3)cc2C1=O |
| InChI | InChI=1S/C20H19N5O3/c1-20(2,3)25-17(26)14-7-6-12(8-15(14)18(25)27)22-19(28)23-13-5-4-11-10-21-24-16(11)9-13/h4-10H,1-3H3,(H,21,24)(H2,22,23,28) |
| InChIKey | VCKLGSDTHKKWJZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|