C15H11F3N4O — CID 108896278
1-(1H-indazol-6-yl)-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 108896278) has the molecular formula C15H11F3N4O and a molecular weight of 320.27 g/mol. Its IUPAC name is 1-(1H-indazol-6-yl)-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(1H-indazol-6-yl)-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 108896278 |
| Molecular Formula | C15H11F3N4O |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 1-(1H-indazol-6-yl)-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)Nc1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C15H11F3N4O/c16-15(17,18)10-2-5-11(6-3-10)20-14(23)21-12-4-1-9-8-19-22-13(9)7-12/h1-8H,(H,19,22)(H2,20,21,23) |
| InChIKey | ARWCGJCPGBNITQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |