C15H10ClF3N4S — CID 2621151
1-[2-chloro-5-(trifluoromethyl)phenyl]-3-(1H-indazol-6-yl)thiourea (PubChem CID 2621151) has the molecular formula C15H10ClF3N4S and a molecular weight of 370.79 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-(1H-indazol-6-yl)thiourea.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-(1H-indazol-6-yl)thiourea |
|---|---|
| PubChem CID | 2621151 |
| Molecular Formula | C15H10ClF3N4S |
| Molecular Weight | 370.79 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-(1H-indazol-6-yl)thiourea |
| SMILES | FC(F)(F)c1ccc(Cl)c(NC(=S)Nc2ccc3cn[nH]c3c2)c1 |
| InChI | InChI=1S/C15H10ClF3N4S/c16-11-4-2-9(15(17,18)19)5-13(11)22-14(24)21-10-3-1-8-7-20-23-12(8)6-10/h1-7H,(H,20,23)(H2,21,22,24) |
| InChIKey | FUVRQHKMSLCJMQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.79 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|