C16H14ClF3N2S — CID 5025528
1-[2-chloro-5-(trifluoromethyl)phenyl]-3-(2,4-dimethylphenyl)thiourea (PubChem CID 5025528) has the molecular formula C16H14ClF3N2S and a molecular weight of 358.82 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-(2,4-dimethylphenyl)thiourea.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-(2,4-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 5025528 |
| Molecular Formula | C16H14ClF3N2S |
| Molecular Weight | 358.82 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-(2,4-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)Nc2cc(C(F)(F)F)ccc2Cl)c(C)c1 |
| InChI | InChI=1S/C16H14ClF3N2S/c1-9-3-6-13(10(2)7-9)21-15(23)22-14-8-11(16(18,19)20)4-5-12(14)17/h3-8H,1-2H3,(H2,21,22,23) |
| InChIKey | LIZOBHFOTOHLKF-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.82 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|