C13H20N2S — CID 2797643
1-tert-butyl-3-(2,4-dimethylphenyl)thiourea (PubChem CID 2797643) has the molecular formula C13H20N2S and a molecular weight of 236.38 g/mol. Its IUPAC name is 1-tert-butyl-3-(2,4-dimethylphenyl)thiourea.
| Compound Name | 1-tert-butyl-3-(2,4-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 2797643 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 1-tert-butyl-3-(2,4-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C13H20N2S/c1-9-6-7-11(10(2)8-9)14-12(16)15-13(3,4)5/h6-8H,1-5H3,(H2,14,15,16) |
| InChIKey | AUNJDRSCRMHJMR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|