C13H20N2S — CID 2363033
1-[(2R)-butan-2-yl]-3-(2,4-dimethylphenyl)thiourea (PubChem CID 2363033) has the molecular formula C13H20N2S and a molecular weight of 236.38 g/mol. Its IUPAC name is 1-[(2R)-butan-2-yl]-3-(2,4-dimethylphenyl)thiourea.
| Compound Name | 1-[(2R)-butan-2-yl]-3-(2,4-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 2363033 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 1-[(2R)-butan-2-yl]-3-(2,4-dimethylphenyl)thiourea |
| SMILES | CC[C@@H](C)NC(=S)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C13H20N2S/c1-5-11(4)14-13(16)15-12-7-6-9(2)8-10(12)3/h6-8,11H,5H2,1-4H3,(H2,14,15,16)/t11-/m1/s1 |
| InChIKey | QZZNCNDYOAYOJQ-LLVKDONJSA-N |
| XLogP | 3.39 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|