C21H28N2S — CID 100746365
1-(2,4-dimethylphenyl)-3-[(1S)-1-(2,4-dimethylphenyl)-2-methylpropyl]thiourea (PubChem CID 100746365) has the molecular formula C21H28N2S and a molecular weight of 340.54 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-[(1S)-1-(2,4-dimethylphenyl)-2-methylpropyl]thiourea.
| Compound Name | 1-(2,4-dimethylphenyl)-3-[(1S)-1-(2,4-dimethylphenyl)-2-methylpropyl]thiourea |
|---|---|
| PubChem CID | 100746365 |
| Molecular Formula | C21H28N2S |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-[(1S)-1-(2,4-dimethylphenyl)-2-methylpropyl]thiourea |
| SMILES | Cc1ccc(NC(=S)N[C@H](c2ccc(C)cc2C)C(C)C)c(C)c1 |
| InChI | InChI=1S/C21H28N2S/c1-13(2)20(18-9-7-14(3)11-16(18)5)23-21(24)22-19-10-8-15(4)12-17(19)6/h7-13,20H,1-6H3,(H2,22,23,24)/t20-/m0/s1 |
| InChIKey | SJQQIUSGNFASGB-FQEVSTJZSA-N |
| XLogP | 5.60 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|