C19H22BrFN2S — CID 133218202
1-(4-bromo-2-fluorophenyl)-3-[1-(2,4-dimethylphenyl)-2-methylpropyl]thiourea (PubChem CID 133218202) has the molecular formula C19H22BrFN2S and a molecular weight of 409.37 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)-3-[1-(2,4-dimethylphenyl)-2-methylpropyl]thiourea.
| Compound Name | 1-(4-bromo-2-fluorophenyl)-3-[1-(2,4-dimethylphenyl)-2-methylpropyl]thiourea |
|---|---|
| PubChem CID | 133218202 |
| Molecular Formula | C19H22BrFN2S |
| Molecular Weight | 409.37 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)-3-[1-(2,4-dimethylphenyl)-2-methylpropyl]thiourea |
| SMILES | Cc1ccc(C(NC(=S)Nc2ccc(Br)cc2F)C(C)C)c(C)c1 |
| InChI | InChI=1S/C19H22BrFN2S/c1-11(2)18(15-7-5-12(3)9-13(15)4)23-19(24)22-17-8-6-14(20)10-16(17)21/h5-11,18H,1-4H3,(H2,22,23,24) |
| InChIKey | TUBXEXYYMLPAQS-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.37 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|