C18H20BrFN2S — CID 133218127
1-(4-bromo-2-fluorophenyl)-3-[2-methyl-1-(2-methylphenyl)propyl]thiourea (PubChem CID 133218127) has the molecular formula C18H20BrFN2S and a molecular weight of 395.34 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)-3-[2-methyl-1-(2-methylphenyl)propyl]thiourea.
| Compound Name | 1-(4-bromo-2-fluorophenyl)-3-[2-methyl-1-(2-methylphenyl)propyl]thiourea |
|---|---|
| PubChem CID | 133218127 |
| Molecular Formula | C18H20BrFN2S |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)-3-[2-methyl-1-(2-methylphenyl)propyl]thiourea |
| SMILES | Cc1ccccc1C(NC(=S)Nc1ccc(Br)cc1F)C(C)C |
| InChI | InChI=1S/C18H20BrFN2S/c1-11(2)17(14-7-5-4-6-12(14)3)22-18(23)21-16-9-8-13(19)10-15(16)20/h4-11,17H,1-3H3,(H2,21,22,23) |
| InChIKey | IWUPLCVQQOQHHO-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|