C17H18BrFN2S — CID 133215384
1-(4-bromo-2-fluorophenyl)-3-[1-(2,4-dimethylphenyl)ethyl]thiourea (PubChem CID 133215384) has the molecular formula C17H18BrFN2S and a molecular weight of 381.31 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)-3-[1-(2,4-dimethylphenyl)ethyl]thiourea.
| Compound Name | 1-(4-bromo-2-fluorophenyl)-3-[1-(2,4-dimethylphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 133215384 |
| Molecular Formula | C17H18BrFN2S |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)-3-[1-(2,4-dimethylphenyl)ethyl]thiourea |
| SMILES | Cc1ccc(C(C)NC(=S)Nc2ccc(Br)cc2F)c(C)c1 |
| InChI | InChI=1S/C17H18BrFN2S/c1-10-4-6-14(11(2)8-10)12(3)20-17(22)21-16-7-5-13(18)9-15(16)19/h4-9,12H,1-3H3,(H2,20,21,22) |
| InChIKey | PFIRGDVNPRZQAN-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|