C21H18BrFN2S — CID 100660810
1-(4-bromo-2-fluorophenyl)-3-[(S)-(4-methylphenyl)-phenylmethyl]thiourea (PubChem CID 100660810) has the molecular formula C21H18BrFN2S and a molecular weight of 429.36 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)-3-[(S)-(4-methylphenyl)-phenylmethyl]thiourea.
| Compound Name | 1-(4-bromo-2-fluorophenyl)-3-[(S)-(4-methylphenyl)-phenylmethyl]thiourea |
|---|---|
| PubChem CID | 100660810 |
| Molecular Formula | C21H18BrFN2S |
| Molecular Weight | 429.36 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)-3-[(S)-(4-methylphenyl)-phenylmethyl]thiourea |
| SMILES | Cc1ccc([C@@H](NC(=S)Nc2ccc(Br)cc2F)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H18BrFN2S/c1-14-7-9-16(10-8-14)20(15-5-3-2-4-6-15)25-21(26)24-19-12-11-17(22)13-18(19)23/h2-13,20H,1H3,(H2,24,25,26)/t20-/m0/s1 |
| InChIKey | MXJPFDVMSZUWTB-FQEVSTJZSA-N |
| XLogP | 5.97 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.36 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|