C21H19FN2S — CID 100726835
1-(2-fluorophenyl)-3-[(S)-(3-methylphenyl)-phenylmethyl]thiourea (PubChem CID 100726835) has the molecular formula C21H19FN2S and a molecular weight of 350.46 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[(S)-(3-methylphenyl)-phenylmethyl]thiourea.
| Compound Name | 1-(2-fluorophenyl)-3-[(S)-(3-methylphenyl)-phenylmethyl]thiourea |
|---|---|
| PubChem CID | 100726835 |
| Molecular Formula | C21H19FN2S |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[(S)-(3-methylphenyl)-phenylmethyl]thiourea |
| SMILES | Cc1cccc([C@@H](NC(=S)Nc2ccccc2F)c2ccccc2)c1 |
| InChI | InChI=1S/C21H19FN2S/c1-15-8-7-11-17(14-15)20(16-9-3-2-4-10-16)24-21(25)23-19-13-6-5-12-18(19)22/h2-14,20H,1H3,(H2,23,24,25)/t20-/m0/s1 |
| InChIKey | KEXULGFVZIJAAB-FQEVSTJZSA-N |
| XLogP | 5.21 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|