C18H21FN2S — CID 92693799
1-(2-fluorophenyl)-3-[(1S)-3-methyl-1-phenylbutyl]thiourea (PubChem CID 92693799) has the molecular formula C18H21FN2S and a molecular weight of 316.45 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[(1S)-3-methyl-1-phenylbutyl]thiourea.
| Compound Name | 1-(2-fluorophenyl)-3-[(1S)-3-methyl-1-phenylbutyl]thiourea |
|---|---|
| PubChem CID | 92693799 |
| Molecular Formula | C18H21FN2S |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[(1S)-3-methyl-1-phenylbutyl]thiourea |
| SMILES | CC(C)C[C@H](NC(=S)Nc1ccccc1F)c1ccccc1 |
| InChI | InChI=1S/C18H21FN2S/c1-13(2)12-17(14-8-4-3-5-9-14)21-18(22)20-16-11-7-6-10-15(16)19/h3-11,13,17H,12H2,1-2H3,(H2,20,21,22)/t17-/m0/s1 |
| InChIKey | XAPCWOWEPFFOQF-KRWDZBQOSA-N |
| XLogP | 4.90 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|