C22H22N2S — CID 133216260
1-(3-methylphenyl)-3-[(3-methylphenyl)-phenylmethyl]thiourea (PubChem CID 133216260) has the molecular formula C22H22N2S and a molecular weight of 346.50 g/mol. Its IUPAC name is 1-(3-methylphenyl)-3-[(3-methylphenyl)-phenylmethyl]thiourea.
| Compound Name | 1-(3-methylphenyl)-3-[(3-methylphenyl)-phenylmethyl]thiourea |
|---|---|
| PubChem CID | 133216260 |
| Molecular Formula | C22H22N2S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 1-(3-methylphenyl)-3-[(3-methylphenyl)-phenylmethyl]thiourea |
| SMILES | Cc1cccc(NC(=S)NC(c2ccccc2)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C22H22N2S/c1-16-8-6-12-19(14-16)21(18-10-4-3-5-11-18)24-22(25)23-20-13-7-9-17(2)15-20/h3-15,21H,1-2H3,(H2,23,24,25) |
| InChIKey | USCJOTVVIQWXLJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|