C21H21N3S — CID 133216326
1-[(3-methylphenyl)-phenylmethyl]-3-(6-methyl-2-pyridinyl)thiourea (PubChem CID 133216326) has the molecular formula C21H21N3S and a molecular weight of 347.49 g/mol. Its IUPAC name is 1-[(3-methylphenyl)-phenylmethyl]-3-(6-methyl-2-pyridinyl)thiourea.
| Compound Name | 1-[(3-methylphenyl)-phenylmethyl]-3-(6-methyl-2-pyridinyl)thiourea |
|---|---|
| PubChem CID | 133216326 |
| Molecular Formula | C21H21N3S |
| Molecular Weight | 347.49 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 1-[(3-methylphenyl)-phenylmethyl]-3-(6-methyl-2-pyridinyl)thiourea |
| SMILES | Cc1cccc(C(NC(=S)Nc2cccc(C)n2)c2ccccc2)c1 |
| InChI | InChI=1S/C21H21N3S/c1-15-8-6-12-18(14-15)20(17-10-4-3-5-11-17)24-21(25)23-19-13-7-9-16(2)22-19/h3-14,20H,1-2H3,(H2,22,23,24,25) |
| InChIKey | QOFUJOOBLFDPOM-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.49 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|