C23H22N2O2S — CID 100727132
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(S)-(3-methylphenyl)-phenylmethyl]thiourea (PubChem CID 100727132) has the molecular formula C23H22N2O2S and a molecular weight of 390.51 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(S)-(3-methylphenyl)-phenylmethyl]thiourea.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(S)-(3-methylphenyl)-phenylmethyl]thiourea |
|---|---|
| PubChem CID | 100727132 |
| Molecular Formula | C23H22N2O2S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(S)-(3-methylphenyl)-phenylmethyl]thiourea |
| SMILES | Cc1cccc([C@@H](NC(=S)Nc2ccc3c(c2)OCCO3)c2ccccc2)c1 |
| InChI | InChI=1S/C23H22N2O2S/c1-16-6-5-9-18(14-16)22(17-7-3-2-4-8-17)25-23(28)24-19-10-11-20-21(15-19)27-13-12-26-20/h2-11,14-15,22H,12-13H2,1H3,(H2,24,25,28)/t22-/m0/s1 |
| InChIKey | WWOQVVSXXJLVJS-QFIPXVFZSA-N |
| XLogP | 4.84 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|