C22H22N2OS — CID 9216074
1-[(R)-(4-methoxyphenyl)-phenylmethyl]-3-(3-methylphenyl)thiourea (PubChem CID 9216074) has the molecular formula C22H22N2OS and a molecular weight of 362.50 g/mol. Its IUPAC name is 1-[(R)-(4-methoxyphenyl)-phenylmethyl]-3-(3-methylphenyl)thiourea.
| Compound Name | 1-[(R)-(4-methoxyphenyl)-phenylmethyl]-3-(3-methylphenyl)thiourea |
|---|---|
| PubChem CID | 9216074 |
| Molecular Formula | C22H22N2OS |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 1-[(R)-(4-methoxyphenyl)-phenylmethyl]-3-(3-methylphenyl)thiourea |
| SMILES | COc1ccc([C@H](NC(=S)Nc2cccc(C)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H22N2OS/c1-16-7-6-10-19(15-16)23-22(26)24-21(17-8-4-3-5-9-17)18-11-13-20(25-2)14-12-18/h3-15,21H,1-2H3,(H2,23,24,26)/t21-/m1/s1 |
| InChIKey | OTIQROBKFBERSP-OAQYLSRUSA-N |
| XLogP | 5.08 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|