C24H24N2OS — CID 100661315
1-[(R)-(4-methylphenyl)-phenylmethyl]-3-(3-prop-2-enoxyphenyl)thiourea (PubChem CID 100661315) has the molecular formula C24H24N2OS and a molecular weight of 388.54 g/mol. Its IUPAC name is 1-[(R)-(4-methylphenyl)-phenylmethyl]-3-(3-prop-2-enoxyphenyl)thiourea.
| Compound Name | 1-[(R)-(4-methylphenyl)-phenylmethyl]-3-(3-prop-2-enoxyphenyl)thiourea |
|---|---|
| PubChem CID | 100661315 |
| Molecular Formula | C24H24N2OS |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 1-[(R)-(4-methylphenyl)-phenylmethyl]-3-(3-prop-2-enoxyphenyl)thiourea |
| SMILES | C=CCOc1cccc(NC(=S)N[C@H](c2ccccc2)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C24H24N2OS/c1-3-16-27-22-11-7-10-21(17-22)25-24(28)26-23(19-8-5-4-6-9-19)20-14-12-18(2)13-15-20/h3-15,17,23H,1,16H2,2H3,(H2,25,26,28)/t23-/m1/s1 |
| InChIKey | BKJUJYDLHWAYIX-HSZRJFAPSA-N |
| XLogP | 5.64 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|