C19H23BrN2S — CID 100745811
1-(4-bromo-3-methylphenyl)-3-[(1R)-2-methyl-1-(2-methylphenyl)propyl]thiourea (PubChem CID 100745811) has the molecular formula C19H23BrN2S and a molecular weight of 391.38 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-3-[(1R)-2-methyl-1-(2-methylphenyl)propyl]thiourea.
| Compound Name | 1-(4-bromo-3-methylphenyl)-3-[(1R)-2-methyl-1-(2-methylphenyl)propyl]thiourea |
|---|---|
| PubChem CID | 100745811 |
| Molecular Formula | C19H23BrN2S |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-3-[(1R)-2-methyl-1-(2-methylphenyl)propyl]thiourea |
| SMILES | Cc1cc(NC(=S)N[C@@H](c2ccccc2C)C(C)C)ccc1Br |
| InChI | InChI=1S/C19H23BrN2S/c1-12(2)18(16-8-6-5-7-13(16)3)22-19(23)21-15-9-10-17(20)14(4)11-15/h5-12,18H,1-4H3,(H2,21,22,23)/t18-/m1/s1 |
| InChIKey | QVXYGCOCUALDFZ-GOSISDBHSA-N |
| XLogP | 5.75 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|