C18H21BrN2S — CID 100670113
1-(4-bromo-3-methylphenyl)-3-[(1R)-1-(2,5-dimethylphenyl)ethyl]thiourea (PubChem CID 100670113) has the molecular formula C18H21BrN2S and a molecular weight of 377.35 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-3-[(1R)-1-(2,5-dimethylphenyl)ethyl]thiourea.
| Compound Name | 1-(4-bromo-3-methylphenyl)-3-[(1R)-1-(2,5-dimethylphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 100670113 |
| Molecular Formula | C18H21BrN2S |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-3-[(1R)-1-(2,5-dimethylphenyl)ethyl]thiourea |
| SMILES | Cc1ccc(C)c([C@@H](C)NC(=S)Nc2ccc(Br)c(C)c2)c1 |
| InChI | InChI=1S/C18H21BrN2S/c1-11-5-6-12(2)16(9-11)14(4)20-18(22)21-15-7-8-17(19)13(3)10-15/h5-10,14H,1-4H3,(H2,20,21,22)/t14-/m1/s1 |
| InChIKey | HWUKEHBGAAYNQK-CQSZACIVSA-N |
| XLogP | 5.42 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|