C12H17BrN2OS — CID 8900458
1-(4-bromo-3-methylphenyl)-3-[(2S)-1-methoxypropan-2-yl]thiourea (PubChem CID 8900458) has the molecular formula C12H17BrN2OS and a molecular weight of 317.25 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-3-[(2S)-1-methoxypropan-2-yl]thiourea.
| Compound Name | 1-(4-bromo-3-methylphenyl)-3-[(2S)-1-methoxypropan-2-yl]thiourea |
|---|---|
| PubChem CID | 8900458 |
| Molecular Formula | C12H17BrN2OS |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-3-[(2S)-1-methoxypropan-2-yl]thiourea |
| SMILES | COC[C@H](C)NC(=S)Nc1ccc(Br)c(C)c1 |
| InChI | InChI=1S/C12H17BrN2OS/c1-8-6-10(4-5-11(8)13)15-12(17)14-9(2)7-16-3/h4-6,9H,7H2,1-3H3,(H2,14,15,17)/t9-/m0/s1 |
| InChIKey | OXKHHUADSUELLD-VIFPVBQESA-N |
| XLogP | 3.08 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|