C17H18BrClN2OS — CID 100706550
1-(4-bromo-3-chlorophenyl)-3-[(2R)-1-(2-methylphenoxy)propan-2-yl]thiourea (PubChem CID 100706550) has the molecular formula C17H18BrClN2OS and a molecular weight of 413.77 g/mol. Its IUPAC name is 1-(4-bromo-3-chlorophenyl)-3-[(2R)-1-(2-methylphenoxy)propan-2-yl]thiourea.
| Compound Name | 1-(4-bromo-3-chlorophenyl)-3-[(2R)-1-(2-methylphenoxy)propan-2-yl]thiourea |
|---|---|
| PubChem CID | 100706550 |
| Molecular Formula | C17H18BrClN2OS |
| Molecular Weight | 413.77 g/mol |
| Exact Mass | 412.00 |
| IUPAC Name | 1-(4-bromo-3-chlorophenyl)-3-[(2R)-1-(2-methylphenoxy)propan-2-yl]thiourea |
| SMILES | Cc1ccccc1OC[C@@H](C)NC(=S)Nc1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C17H18BrClN2OS/c1-11-5-3-4-6-16(11)22-10-12(2)20-17(23)21-13-7-8-14(18)15(19)9-13/h3-9,12H,10H2,1-2H3,(H2,20,21,23)/t12-/m1/s1 |
| InChIKey | HKHRKEUKRQSCHG-GFCCVEGCSA-N |
| XLogP | 5.16 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.77 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|