C17H18ClFN2O2S — CID 100751450
1-(3-chloro-4-fluorophenyl)-3-[(2S)-1-(2-methoxyphenoxy)propan-2-yl]thiourea (PubChem CID 100751450) has the molecular formula C17H18ClFN2O2S and a molecular weight of 368.86 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[(2S)-1-(2-methoxyphenoxy)propan-2-yl]thiourea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[(2S)-1-(2-methoxyphenoxy)propan-2-yl]thiourea |
|---|---|
| PubChem CID | 100751450 |
| Molecular Formula | C17H18ClFN2O2S |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[(2S)-1-(2-methoxyphenoxy)propan-2-yl]thiourea |
| SMILES | COc1ccccc1OC[C@H](C)NC(=S)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C17H18ClFN2O2S/c1-11(10-23-16-6-4-3-5-15(16)22-2)20-17(24)21-12-7-8-14(19)13(18)9-12/h3-9,11H,10H2,1-2H3,(H2,20,21,24)/t11-/m0/s1 |
| InChIKey | SCKPIIRNRHGDRN-NSHDSACASA-N |
| XLogP | 4.24 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|