C18H22ClFN3OS+ — CID 8677635
[(1R)-2-[(3-chloro-4-fluorophenyl)carbamothioylamino]-1-(2-methoxyphenyl)ethyl]-dimethylazanium (PubChem CID 8677635) has the molecular formula C18H22ClFN3OS+ and a molecular weight of 382.91 g/mol. Its IUPAC name is [(1R)-2-[(3-chloro-4-fluorophenyl)carbamothioylamino]-1-(2-methoxyphenyl)ethyl]-dimethylazanium.
| Compound Name | [(1R)-2-[(3-chloro-4-fluorophenyl)carbamothioylamino]-1-(2-methoxyphenyl)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8677635 |
| Molecular Formula | C18H22ClFN3OS+ |
| Molecular Weight | 382.91 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | [(1R)-2-[(3-chloro-4-fluorophenyl)carbamothioylamino]-1-(2-methoxyphenyl)ethyl]-dimethylazanium |
| SMILES | COc1ccccc1[C@H](CNC(=S)Nc1ccc(F)c(Cl)c1)[NH+](C)C |
| InChI | InChI=1S/C18H21ClFN3OS/c1-23(2)16(13-6-4-5-7-17(13)24-3)11-21-18(25)22-12-8-9-15(20)14(19)10-12/h4-10,16H,11H2,1-3H3,(H2,21,22,25)/p+1/t16-/m0/s1 |
| InChIKey | DLASHWHXKDECOC-INIZCTEOSA-O |
| XLogP | 2.66 |
| TPSA | 37.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.91 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|