C18H22ClFN3S+ — CID 8678722
[(2R)-1-[(3-chloro-4-fluorophenyl)carbamothioylamino]-3-phenylpropan-2-yl]-dimethylazanium (PubChem CID 8678722) has the molecular formula C18H22ClFN3S+ and a molecular weight of 366.91 g/mol. Its IUPAC name is [(2R)-1-[(3-chloro-4-fluorophenyl)carbamothioylamino]-3-phenylpropan-2-yl]-dimethylazanium.
| Compound Name | [(2R)-1-[(3-chloro-4-fluorophenyl)carbamothioylamino]-3-phenylpropan-2-yl]-dimethylazanium |
|---|---|
| PubChem CID | 8678722 |
| Molecular Formula | C18H22ClFN3S+ |
| Molecular Weight | 366.91 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | [(2R)-1-[(3-chloro-4-fluorophenyl)carbamothioylamino]-3-phenylpropan-2-yl]-dimethylazanium |
| SMILES | C[NH+](C)[C@@H](CNC(=S)Nc1ccc(F)c(Cl)c1)Cc1ccccc1 |
| InChI | InChI=1S/C18H21ClFN3S/c1-23(2)15(10-13-6-4-3-5-7-13)12-21-18(24)22-14-8-9-17(20)16(19)11-14/h3-9,11,15H,10,12H2,1-2H3,(H2,21,22,24)/p+1/t15-/m1/s1 |
| InChIKey | NYRVTNQVLLDAMM-OAHLLOKOSA-O |
| XLogP | 2.52 |
| TPSA | 28.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.91 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|