C18H22ClN3S — CID 8678651
1-(4-chlorophenyl)-3-[(2R)-2-(dimethylamino)-3-phenylpropyl]thiourea (PubChem CID 8678651) has the molecular formula C18H22ClN3S and a molecular weight of 347.92 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(2R)-2-(dimethylamino)-3-phenylpropyl]thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-[(2R)-2-(dimethylamino)-3-phenylpropyl]thiourea |
|---|---|
| PubChem CID | 8678651 |
| Molecular Formula | C18H22ClN3S |
| Molecular Weight | 347.92 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(2R)-2-(dimethylamino)-3-phenylpropyl]thiourea |
| SMILES | CN(C)[C@@H](CNC(=S)Nc1ccc(Cl)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C18H22ClN3S/c1-22(2)17(12-14-6-4-3-5-7-14)13-20-18(23)21-16-10-8-15(19)9-11-16/h3-11,17H,12-13H2,1-2H3,(H2,20,21,23)/t17-/m1/s1 |
| InChIKey | KFXOKYDOTISNAW-QGZVFWFLSA-N |
| XLogP | 3.80 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.92 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|