C19H23F2N3OS — CID 8656067
1-[4-(difluoromethoxy)phenyl]-3-[(2S)-2-(dimethylamino)-3-phenylpropyl]thiourea (PubChem CID 8656067) has the molecular formula C19H23F2N3OS and a molecular weight of 379.48 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-3-[(2S)-2-(dimethylamino)-3-phenylpropyl]thiourea.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-3-[(2S)-2-(dimethylamino)-3-phenylpropyl]thiourea |
|---|---|
| PubChem CID | 8656067 |
| Molecular Formula | C19H23F2N3OS |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-3-[(2S)-2-(dimethylamino)-3-phenylpropyl]thiourea |
| SMILES | CN(C)[C@H](CNC(=S)Nc1ccc(OC(F)F)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C19H23F2N3OS/c1-24(2)16(12-14-6-4-3-5-7-14)13-22-19(26)23-15-8-10-17(11-9-15)25-18(20)21/h3-11,16,18H,12-13H2,1-2H3,(H2,22,23,26)/t16-/m0/s1 |
| InChIKey | MFYYFGBSRXYAGT-INIZCTEOSA-N |
| XLogP | 3.75 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|