C19H23F2N3O2S — CID 8656322
1-[4-(difluoromethoxy)phenyl]-3-[(2R)-2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]thiourea (PubChem CID 8656322) has the molecular formula C19H23F2N3O2S and a molecular weight of 395.48 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-3-[(2R)-2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]thiourea.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-3-[(2R)-2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 8656322 |
| Molecular Formula | C19H23F2N3O2S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-3-[(2R)-2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]thiourea |
| SMILES | COc1cccc([C@H](CNC(=S)Nc2ccc(OC(F)F)cc2)N(C)C)c1 |
| InChI | InChI=1S/C19H23F2N3O2S/c1-24(2)17(13-5-4-6-16(11-13)25-3)12-22-19(27)23-14-7-9-15(10-8-14)26-18(20)21/h4-11,17-18H,12H2,1-3H3,(H2,22,23,27)/t17-/m0/s1 |
| InChIKey | PFXKLHMRNTTXLQ-KRWDZBQOSA-N |
| XLogP | 3.89 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|